C5H6N4O3 — CID 138747922
(6S)-6-hydroxy-3,6,7,9-tetrahydro-1H-purine-2,8-dione (PubChem CID 138747922) has the molecular formula C5H6N4O3 and a molecular weight of 170.13 g/mol. Its IUPAC name is (6S)-6-hydroxy-3,6,7,9-tetrahydro-1H-purine-2,8-dione.
| Compound Name | (6S)-6-hydroxy-3,6,7,9-tetrahydro-1H-purine-2,8-dione |
|---|---|
| PubChem CID | 138747922 |
| Molecular Formula | C5H6N4O3 |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | (6S)-6-hydroxy-3,6,7,9-tetrahydro-1H-purine-2,8-dione |
| SMILES | O=C1Nc2[nH]c(=O)[nH]c2[C@H](O)N1 |
| InChI | InChI=1S/C5H6N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h3,10H,(H2,6,7,11)(H2,8,9,12)/t3-/m0/s1 |
| InChIKey | CRVPZZWTYVGRLE-VKHMYHEASA-N |
| XLogP | -1.17 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |