C19H24FN5O8S2 — CID 138748067
(2,5-dioxopyrrolidin-1-yl) 4-[2-[2-[3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanoylamino]ethyldisulfanyl]ethylamino]-4-oxobutanoate (PubChem CID 138748067) has the molecular formula C19H24FN5O8S2 and a molecular weight of 533.56 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[2-[2-[3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanoylamino]ethyldisulfanyl]ethylamino]-4-oxobutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[2-[3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanoylamino]ethyldisulfanyl]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 138748067 |
| Molecular Formula | C19H24FN5O8S2 |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[2-[3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanoylamino]ethyldisulfanyl]ethylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)ON1C(=O)CCC1=O)NCCSSCCNC(=O)CCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H24FN5O8S2/c20-12-11-24(19(32)23-18(12)31)8-5-14(27)22-7-10-35-34-9-6-21-13(26)1-4-17(30)33-25-15(28)2-3-16(25)29/h11H,1-10H2,(H,21,26)(H,22,27)(H,23,31,32) |
| InChIKey | ONEZTQJBKCOUJS-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 176.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|