About 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine
4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine (PubChem CID 138748237) has the molecular formula C15H18ClN3
and a molecular weight of 275.78 g/mol. Its IUPAC name is 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 138748237 |
| Molecular Formula | C15H18ClN3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine |
| SMILES | CC(C)=CC1CCC(n2ccc3c(Cl)ncnc32)C1 |
| InChI | InChI=1S/C15H18ClN3/c1-10(2)7-11-3-4-12(8-11)19-6-5-13-14(16)17-9-18-15(13)19/h5-7,9,11-12H,3-4,8H2,1-2H3 |
| InChIKey | PMJPQKHSELYADP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine (CID 138748237) is 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine is CC(C)=CC1CCC(n2ccc3c(Cl)ncnc32)C1.
What is the InChIKey of 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine?
The InChIKey is PMJPQKHSELYADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3/c1-10(2)7-11-3-4-12(8-11)19-6-5-13-14(16)17-9-18-15(13)19/h5-7,9,11-12H,3-4,8H2,1-2H3.
What are the key properties of 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine?
4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine has a molecular weight of 275.78 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7-[3-(2-methylprop-1-enyl)cyclopentyl]pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 138748237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).