About [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone
[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone (PubChem CID 138748332) has the molecular formula C15H16ClN3O
and a molecular weight of 289.77 g/mol. Its IUPAC name is [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone.
Molecular Properties
| Compound Name | [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone |
| PubChem CID | 138748332 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)C1CCC(n2ccc3c(Cl)ncnc32)C1 |
| InChI | InChI=1S/C15H16ClN3O/c16-14-12-5-6-19(15(12)18-8-17-14)11-4-3-10(7-11)13(20)9-1-2-9/h5-6,8-11H,1-4,7H2 |
| InChIKey | NZHRJDDSTJEZAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone?
The IUPAC name of [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone (CID 138748332) is [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone.
What is the SMILES notation for [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone?
The canonical SMILES for [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone is O=C(C1CC1)C1CCC(n2ccc3c(Cl)ncnc32)C1.
What is the InChIKey of [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone?
The InChIKey is NZHRJDDSTJEZAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN3O/c16-14-12-5-6-19(15(12)18-8-17-14)11-4-3-10(7-11)13(20)9-1-2-9/h5-6,8-11H,1-4,7H2.
What are the key properties of [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone?
[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone has a molecular weight of 289.77 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]-cyclopropylmethanone is sourced from PubChem (CID 138748332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).