About 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole
2-methyl-4-pentan-2-yl-1,3-dihydrotriazole (PubChem CID 138748386) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole.
Molecular Properties
| Compound Name | 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole |
| PubChem CID | 138748386 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole |
| SMILES | CCCC(C)C1=CNN(C)N1 |
| InChI | InChI=1S/C8H17N3/c1-4-5-7(2)8-6-9-11(3)10-8/h6-7,9-10H,4-5H2,1-3H3 |
| InChIKey | QRHBTNARJZMYFR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole?
The IUPAC name of 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole (CID 138748386) is 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole.
What is the SMILES notation for 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole?
The canonical SMILES for 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole is CCCC(C)C1=CNN(C)N1.
What is the InChIKey of 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole?
The InChIKey is QRHBTNARJZMYFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-4-5-7(2)8-6-9-11(3)10-8/h6-7,9-10H,4-5H2,1-3H3.
What are the key properties of 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole?
2-methyl-4-pentan-2-yl-1,3-dihydrotriazole has a molecular weight of 155.25 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-pentan-2-yl-1,3-dihydrotriazole is sourced from PubChem (CID 138748386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).