C19H30O12P2 — CID 138749354
bis[(1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl] 2,2,4,4-tetramethylpentanedioate (PubChem CID 138749354) has the molecular formula C19H30O12P2 and a molecular weight of 512.39 g/mol. Its IUPAC name is bis[(1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl] 2,2,4,4-tetramethylpentanedioate.
| Compound Name | bis[(1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl] 2,2,4,4-tetramethylpentanedioate |
|---|---|
| PubChem CID | 138749354 |
| Molecular Formula | C19H30O12P2 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | bis[(1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl] 2,2,4,4-tetramethylpentanedioate |
| SMILES | CC(C)(CC(C)(C)C(=O)OCC12COP(=O)(OC1)OC2)C(=O)OCC12COP(=O)(OC1)OC2 |
| InChI | InChI=1S/C19H30O12P2/c1-16(2,14(20)24-6-18-8-26-32(22,27-9-18)28-10-18)5-17(3,4)15(21)25-7-19-11-29-33(23,30-12-19)31-13-19/h5-13H2,1-4H3 |
| InChIKey | QXFRDVCQVOIOFA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|