About (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione
(3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione (PubChem CID 138749474) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione.
Molecular Properties
| Compound Name | (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione |
| PubChem CID | 138749474 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione |
| SMILES | CN/C=C/C=C(/C)C(C)=S |
| InChI | InChI=1S/C8H13NS/c1-7(8(2)10)5-4-6-9-3/h4-6,9H,1-3H3/b6-4+,7-5- |
| InChIKey | GKLGVZBMTFVIHK-GUBXDBFYSA-N |
| XLogP | 2.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione?
The IUPAC name of (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione (CID 138749474) is (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione.
What is the SMILES notation for (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione?
The canonical SMILES for (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione is CN/C=C/C=C(/C)C(C)=S.
What is the InChIKey of (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione?
The InChIKey is GKLGVZBMTFVIHK-GUBXDBFYSA-N. The full InChI is InChI=1S/C8H13NS/c1-7(8(2)10)5-4-6-9-3/h4-6,9H,1-3H3/b6-4+,7-5-.
What are the key properties of (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione?
(3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione has a molecular weight of 155.27 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-3-methyl-6-(methylamino)hexa-3,5-diene-2-thione is sourced from PubChem (CID 138749474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).