C12H21NO — CID 138749490
(1E)-1-[(3S,5R)-3,5-dimethyl-3-prop-2-enyloxolan-2-ylidene]propan-2-amine (PubChem CID 138749490) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (1E)-1-[(3S,5R)-3,5-dimethyl-3-prop-2-enyloxolan-2-ylidene]propan-2-amine.
| Compound Name | (1E)-1-[(3S,5R)-3,5-dimethyl-3-prop-2-enyloxolan-2-ylidene]propan-2-amine |
|---|---|
| PubChem CID | 138749490 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (1E)-1-[(3S,5R)-3,5-dimethyl-3-prop-2-enyloxolan-2-ylidene]propan-2-amine |
| SMILES | C=CC[C@@]1(C)C[C@@H](C)O/C1=C/C(C)N |
| InChI | InChI=1S/C12H21NO/c1-5-6-12(4)8-10(3)14-11(12)7-9(2)13/h5,7,9-10H,1,6,8,13H2,2-4H3/b11-7+/t9?,10-,12+/m1/s1 |
| InChIKey | KQIPDGODKDASFX-FNSNTLIHSA-N |
| XLogP | 2.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|