C11H8F13NO2 — CID 138749655
1,1,1,2,4,4,5,5,6,6-decafluoro-6-morpholin-4-yl-2-(trifluoromethyl)hexan-3-one (PubChem CID 138749655) has the molecular formula C11H8F13NO2 and a molecular weight of 433.16 g/mol. Its IUPAC name is 1,1,1,2,4,4,5,5,6,6-decafluoro-6-morpholin-4-yl-2-(trifluoromethyl)hexan-3-one.
| Compound Name | 1,1,1,2,4,4,5,5,6,6-decafluoro-6-morpholin-4-yl-2-(trifluoromethyl)hexan-3-one |
|---|---|
| PubChem CID | 138749655 |
| Molecular Formula | C11H8F13NO2 |
| Molecular Weight | 433.16 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 1,1,1,2,4,4,5,5,6,6-decafluoro-6-morpholin-4-yl-2-(trifluoromethyl)hexan-3-one |
| SMILES | O=C(C(F)(F)C(F)(F)C(F)(F)N1CCOCC1)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F13NO2/c12-6(9(17,18)19,10(20,21)22)5(26)7(13,14)8(15,16)11(23,24)25-1-3-27-4-2-25/h1-4H2 |
| InChIKey | CFMSQSNNYOCRRS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.16 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|