C13H24FN — CID 138749750
(2S)-5-fluoro-2,9-dimethyl-4-propyl-3,4,5,6,7,8-hexahydro-2H-azonine (PubChem CID 138749750) has the molecular formula C13H24FN and a molecular weight of 213.34 g/mol. Its IUPAC name is (2S)-5-fluoro-2,9-dimethyl-4-propyl-3,4,5,6,7,8-hexahydro-2H-azonine.
| Compound Name | (2S)-5-fluoro-2,9-dimethyl-4-propyl-3,4,5,6,7,8-hexahydro-2H-azonine |
|---|---|
| PubChem CID | 138749750 |
| Molecular Formula | C13H24FN |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | (2S)-5-fluoro-2,9-dimethyl-4-propyl-3,4,5,6,7,8-hexahydro-2H-azonine |
| SMILES | CCCC1C[C@H](C)/N=C(/C)CCCC1F |
| InChI | InChI=1S/C13H24FN/c1-4-6-12-9-11(3)15-10(2)7-5-8-13(12)14/h11-13H,4-9H2,1-3H3/b15-10-/t11-,12?,13?/m0/s1 |
| InChIKey | HMZCLGUMPAZBAE-OBALRMEDSA-N |
| XLogP | 4.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |