C13H18N2 — CID 138749946
5-imino-8-methyl-6-methylidene-4a,7,8,9-tetrahydro-4H-benzo[7]annulen-2-amine (PubChem CID 138749946) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-imino-8-methyl-6-methylidene-4a,7,8,9-tetrahydro-4H-benzo[7]annulen-2-amine.
| Compound Name | 5-imino-8-methyl-6-methylidene-4a,7,8,9-tetrahydro-4H-benzo[7]annulen-2-amine |
|---|---|
| PubChem CID | 138749946 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 5-imino-8-methyl-6-methylidene-4a,7,8,9-tetrahydro-4H-benzo[7]annulen-2-amine |
| SMILES | [H]/N=C1\C(=C)CC(C)CC2=CC(N)=CCC21 |
| InChI | InChI=1S/C13H18N2/c1-8-5-9(2)13(15)12-4-3-11(14)7-10(12)6-8/h3,7-8,12,15H,2,4-6,14H2,1H3/b15-13+ |
| InChIKey | APUNZAARULBPBT-FYWRMAATSA-N |
| XLogP | 2.78 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|