C38H24N4 — CID 138750094
4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]benzonitrile (PubChem CID 138750094) has the molecular formula C38H24N4 and a molecular weight of 536.64 g/mol. Its IUPAC name is 4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]benzonitrile.
| Compound Name | 4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 138750094 |
| Molecular Formula | C38H24N4 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c3ccccc23)cc1 |
| InChI | InChI=1S/C38H24N4/c39-25-26-19-21-27(22-20-26)30-15-7-8-16-31(30)34-23-24-35(33-18-10-9-17-32(33)34)38-41-36(28-11-3-1-4-12-28)40-37(42-38)29-13-5-2-6-14-29/h1-24H |
| InChIKey | MUCOUUJHVYWAQJ-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |