About CID 138750337
CID 138750337 (PubChem CID 138750337) has the molecular formula C26H28N2O3S
and a molecular weight of 448.59 g/mol.
Molecular Properties
| Compound Name | CID 138750337 |
| PubChem CID | 138750337 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)CCC1(CC2)Oc2ccc(OCC3CC3)cc2C12NC(=S)N(C)C2=O |
| InChI | InChI=1S/C26H28N2O3S/c1-16-3-6-18-9-11-25(12-10-19(18)13-16)26(23(29)28(2)24(32)27-26)21-14-20(7-8-22(21)31-25)30-15-17-4-5-17/h3,6-8,13-14,17H,4-5,9-12,15H2,1-2H3,(H,27,32) |
| InChIKey | APNVXNMGBABTCD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 138750337 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138750337?
The IUPAC name of CID 138750337 (CID 138750337) is not available.
What is the SMILES notation for CID 138750337?
The canonical SMILES for CID 138750337 is Cc1ccc2c(c1)CCC1(CC2)Oc2ccc(OCC3CC3)cc2C12NC(=S)N(C)C2=O.
What is the InChIKey of CID 138750337?
The InChIKey is APNVXNMGBABTCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O3S/c1-16-3-6-18-9-11-25(12-10-19(18)13-16)26(23(29)28(2)24(32)27-26)21-14-20(7-8-22(21)31-25)30-15-17-4-5-17/h3,6-8,13-14,17H,4-5,9-12,15H2,1-2H3,(H,27,32).
What are the key properties of CID 138750337?
CID 138750337 has a molecular weight of 448.59 g/mol, XLogP of 4.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138750337 is sourced from PubChem (CID 138750337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).