C17H26N2 — CID 138750425
(2Z,4E,6Z)-3-ethenyl-5-(N-ethenyl-C-methylcarbonimidoyl)-N,2,4-trimethylocta-2,4,6-trien-1-amine (PubChem CID 138750425) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (2Z,4E,6Z)-3-ethenyl-5-(N-ethenyl-C-methylcarbonimidoyl)-N,2,4-trimethylocta-2,4,6-trien-1-amine.
| Compound Name | (2Z,4E,6Z)-3-ethenyl-5-(N-ethenyl-C-methylcarbonimidoyl)-N,2,4-trimethylocta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 138750425 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (2Z,4E,6Z)-3-ethenyl-5-(N-ethenyl-C-methylcarbonimidoyl)-N,2,4-trimethylocta-2,4,6-trien-1-amine |
| SMILES | C=C/N=C(C)/C(/C=C\C)=C(C)/C(C=C)=C(/C)CNC |
| InChI | InChI=1S/C17H26N2/c1-8-11-17(15(6)19-10-3)14(5)16(9-2)13(4)12-18-7/h8-11,18H,2-3,12H2,1,4-7H3/b11-8-,16-13-,17-14+,19-15+ |
| InChIKey | RHPUKSYVECPCHA-CTEIZUKHSA-N |
| XLogP | 4.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|