About [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene
[(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene (PubChem CID 138750453) has the molecular formula C13H12S
and a molecular weight of 200.31 g/mol. Its IUPAC name is [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene.
Molecular Properties
| Compound Name | [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene |
| PubChem CID | 138750453 |
| Molecular Formula | C13H12S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene |
| SMILES | C#C/C=C(\C=C/C)Sc1ccccc1 |
| InChI | InChI=1S/C13H12S/c1-3-8-12(9-4-2)14-13-10-6-5-7-11-13/h1,4-11H,2H3/b9-4-,12-8+ |
| InChIKey | MZGUMJFWXIBHKH-FIOFKEMQSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene?
The IUPAC name of [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene (CID 138750453) is [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene.
What is the SMILES notation for [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene?
The canonical SMILES for [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene is C#C/C=C(\C=C/C)Sc1ccccc1.
What is the InChIKey of [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene?
The InChIKey is MZGUMJFWXIBHKH-FIOFKEMQSA-N. The full InChI is InChI=1S/C13H12S/c1-3-8-12(9-4-2)14-13-10-6-5-7-11-13/h1,4-11H,2H3/b9-4-,12-8+.
What are the key properties of [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene?
[(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene has a molecular weight of 200.31 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]sulfanylbenzene is sourced from PubChem (CID 138750453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).