C17H33N3O2 — CID 138750541
2-[(6S)-2-[(1S)-1-hydroxypropyl]-1,2,3,6-tetrahydropyridin-6-yl]-N-[4-(propylamino)butyl]acetamide (PubChem CID 138750541) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-[(6S)-2-[(1S)-1-hydroxypropyl]-1,2,3,6-tetrahydropyridin-6-yl]-N-[4-(propylamino)butyl]acetamide.
| Compound Name | 2-[(6S)-2-[(1S)-1-hydroxypropyl]-1,2,3,6-tetrahydropyridin-6-yl]-N-[4-(propylamino)butyl]acetamide |
|---|---|
| PubChem CID | 138750541 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 2-[(6S)-2-[(1S)-1-hydroxypropyl]-1,2,3,6-tetrahydropyridin-6-yl]-N-[4-(propylamino)butyl]acetamide |
| SMILES | CCCNCCCCNC(=O)C[C@H]1C=CCC([C@@H](O)CC)N1 |
| InChI | InChI=1S/C17H33N3O2/c1-3-10-18-11-5-6-12-19-17(22)13-14-8-7-9-15(20-14)16(21)4-2/h7-8,14-16,18,20-21H,3-6,9-13H2,1-2H3,(H,19,22)/t14-,15?,16+/m1/s1 |
| InChIKey | UPAPFMXXDHPNIJ-TUOGLVOQSA-N |
| XLogP | 1.33 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|