About ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate
ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate (PubChem CID 138750983) has the molecular formula C16H20F3NO3S
and a molecular weight of 363.40 g/mol. Its IUPAC name is ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate |
| PubChem CID | 138750983 |
| Molecular Formula | C16H20F3NO3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1cccc(/C(C)=N/[S@](=O)C(C)(C)C)c1F |
| InChI | InChI=1S/C16H20F3NO3S/c1-6-23-14(21)16(18,19)12-9-7-8-11(13(12)17)10(2)20-24(22)15(3,4)5/h7-9H,6H2,1-5H3/b20-10+/t24-/m1/s1 |
| InChIKey | FCECBOGDWDCVLU-LPSMDMKWSA-N |
| XLogP | 3.75 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate?
The IUPAC name of ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate (CID 138750983) is ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate is CCOC(=O)C(F)(F)c1cccc(/C(C)=N/[S@](=O)C(C)(C)C)c1F.
What is the InChIKey of ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate?
The InChIKey is FCECBOGDWDCVLU-LPSMDMKWSA-N. The full InChI is InChI=1S/C16H20F3NO3S/c1-6-23-14(21)16(18,19)12-9-7-8-11(13(12)17)10(2)20-24(22)15(3,4)5/h7-9H,6H2,1-5H3/b20-10+/t24-/m1/s1.
What are the key properties of ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate?
ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate has a molecular weight of 363.40 g/mol, XLogP of 3.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-[(E)-N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-2-fluorophenyl]-2,2-difluoroacetate is sourced from PubChem (CID 138750983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).