C20H24FN9O11P2 — CID 138751047
9-[(10S)-8-(6-aminopurin-9-yl)-18-fluoro-3,12-dihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-7,8-dihydro-1H-purin-6-one (PubChem CID 138751047) has the molecular formula C20H24FN9O11P2 and a molecular weight of 647.41 g/mol. Its IUPAC name is 9-[(10S)-8-(6-aminopurin-9-yl)-18-fluoro-3,12-dihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-7,8-dihydro-1H-purin-6-one.
| Compound Name | 9-[(10S)-8-(6-aminopurin-9-yl)-18-fluoro-3,12-dihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-7,8-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 138751047 |
| Molecular Formula | C20H24FN9O11P2 |
| Molecular Weight | 647.41 g/mol |
| Exact Mass | 647.11 |
| IUPAC Name | 9-[(10S)-8-(6-aminopurin-9-yl)-18-fluoro-3,12-dihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-7,8-dihydro-1H-purin-6-one |
| SMILES | Nc1ncnc2c1ncn2C1C[C@@H]2OP(=O)(O)OCC3OC(N4CNc5c4nc[nH]c5=O)C(OP(=O)(O)OCC2O1)C3F |
| InChI | InChI=1S/C20H24FN9O11P2/c21-12-10-3-37-42(32,33)40-8-1-11(29-6-27-13-16(22)23-4-24-17(13)29)38-9(8)2-36-43(34,35)41-15(12)20(39-10)30-7-28-14-18(30)25-5-26-19(14)31/h4-6,8-12,15,20,28H,1-3,7H2,(H,32,33)(H,34,35)(H2,22,23,24)(H,25,26,31)/t8-,9?,10?,11?,12?,15?,20?/m0/s1 |
| InChIKey | RZHKATUBQVFOMI-NSYYLGMKSA-N |
| XLogP | -0.25 |
| TPSA | 260.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.41 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|