C18H28N2 — CID 138751194
N-(1-cyclohexa-2,4-dien-1-ylpropyl)-3-methylimino-N-propylpenta-1,4-dien-2-amine (PubChem CID 138751194) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-(1-cyclohexa-2,4-dien-1-ylpropyl)-3-methylimino-N-propylpenta-1,4-dien-2-amine.
| Compound Name | N-(1-cyclohexa-2,4-dien-1-ylpropyl)-3-methylimino-N-propylpenta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 138751194 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-(1-cyclohexa-2,4-dien-1-ylpropyl)-3-methylimino-N-propylpenta-1,4-dien-2-amine |
| SMILES | C=C/C(=N\C)C(=C)N(CCC)C(CC)C1C=CC=CC1 |
| InChI | InChI=1S/C18H28N2/c1-6-14-20(15(4)17(7-2)19-5)18(8-3)16-12-10-9-11-13-16/h7,9-12,16,18H,2,4,6,8,13-14H2,1,3,5H3/b19-17+ |
| InChIKey | JLTCBPMIBUFBEC-HTXNQAPBSA-N |
| XLogP | 4.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|