C30H34NO2+ — CID 138751208
1,3,3-trimethyl-2-[(E)-2-[6-[(2-methylpropan-2-yl)oxy]-2,3-dihydro-1H-xanthen-4-yl]ethenyl]indol-1-ium (PubChem CID 138751208) has the molecular formula C30H34NO2+ and a molecular weight of 440.61 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(E)-2-[6-[(2-methylpropan-2-yl)oxy]-2,3-dihydro-1H-xanthen-4-yl]ethenyl]indol-1-ium.
| Compound Name | 1,3,3-trimethyl-2-[(E)-2-[6-[(2-methylpropan-2-yl)oxy]-2,3-dihydro-1H-xanthen-4-yl]ethenyl]indol-1-ium |
|---|---|
| PubChem CID | 138751208 |
| Molecular Formula | C30H34NO2+ |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 1,3,3-trimethyl-2-[(E)-2-[6-[(2-methylpropan-2-yl)oxy]-2,3-dihydro-1H-xanthen-4-yl]ethenyl]indol-1-ium |
| SMILES | C[N+]1=C(/C=C/C2=C3Oc4cc(OC(C)(C)C)ccc4C=C3CCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H34NO2/c1-29(2,3)33-23-16-14-21-18-22-11-9-10-20(28(22)32-26(21)19-23)15-17-27-30(4,5)24-12-7-8-13-25(24)31(27)6/h7-8,12-19H,9-11H2,1-6H3/q+1/b17-15+ |
| InChIKey | SKJYMOCTESFQQA-BMRADRMJSA-N |
| XLogP | 7.34 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|