C21H40FNO — CID 138751919
4-[6-(3-fluorocyclopentyl)-3,9-dimethyldecyl]morpholine (PubChem CID 138751919) has the molecular formula C21H40FNO and a molecular weight of 341.56 g/mol. Its IUPAC name is 4-[6-(3-fluorocyclopentyl)-3,9-dimethyldecyl]morpholine.
| Compound Name | 4-[6-(3-fluorocyclopentyl)-3,9-dimethyldecyl]morpholine |
|---|---|
| PubChem CID | 138751919 |
| Molecular Formula | C21H40FNO |
| Molecular Weight | 341.56 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | 4-[6-(3-fluorocyclopentyl)-3,9-dimethyldecyl]morpholine |
| SMILES | CC(C)CCC(CCC(C)CCN1CCOCC1)C1CCC(F)C1 |
| InChI | InChI=1S/C21H40FNO/c1-17(2)4-6-19(20-8-9-21(22)16-20)7-5-18(3)10-11-23-12-14-24-15-13-23/h17-21H,4-16H2,1-3H3 |
| InChIKey | LKWMHGYKTMODDU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |