About trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol
trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol (PubChem CID 138752546) has the molecular formula C9H16F2OS
and a molecular weight of 210.29 g/mol. Its IUPAC name is trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol |
| PubChem CID | 138752546 |
| Molecular Formula | C9H16F2OS |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol |
| SMILES | CC(S)C[C@H]1CC(F)(F)CC[C@H]1O |
| InChI | InChI=1S/C9H16F2OS/c1-6(13)4-7-5-9(10,11)3-2-8(7)12/h6-8,12-13H,2-5H2,1H3/t6?,7-,8+/m0/s1 |
| InChIKey | DDPBFJBZFFOBHW-ZHFSPANRSA-N |
| XLogP | 2.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol?
The IUPAC name of trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol (CID 138752546) is trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol.
What is the SMILES notation for trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol?
The canonical SMILES for trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol is CC(S)C[C@H]1CC(F)(F)CC[C@H]1O.
What is the InChIKey of trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol?
The InChIKey is DDPBFJBZFFOBHW-ZHFSPANRSA-N. The full InChI is InChI=1S/C9H16F2OS/c1-6(13)4-7-5-9(10,11)3-2-8(7)12/h6-8,12-13H,2-5H2,1H3/t6?,7-,8+/m0/s1.
What are the key properties of trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol?
trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol has a molecular weight of 210.29 g/mol, XLogP of 2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-4,4-difluoro-2-(2-sulfanylpropyl)cyclohexan-1-ol is sourced from PubChem (CID 138752546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).