C7H10Cl2N4S — CID 138752611
5-methyl-2,1,3-benzothiadiazole-4,7-diamine;dihydrochloride (PubChem CID 138752611) has the molecular formula C7H10Cl2N4S and a molecular weight of 253.16 g/mol. Its IUPAC name is 5-methyl-2,1,3-benzothiadiazole-4,7-diamine;dihydrochloride.
| Compound Name | 5-methyl-2,1,3-benzothiadiazole-4,7-diamine;dihydrochloride |
|---|---|
| PubChem CID | 138752611 |
| Molecular Formula | C7H10Cl2N4S |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 5-methyl-2,1,3-benzothiadiazole-4,7-diamine;dihydrochloride |
| SMILES | Cc1cc(N)c2nsnc2c1N.Cl.Cl |
| InChI | InChI=1S/C7H8N4S.2ClH/c1-3-2-4(8)6-7(5(3)9)11-12-10-6;;/h2H,8-9H2,1H3;2*1H |
| InChIKey | VJRZKNPBMOKGLU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|