C21H21ClN2O6S — CID 138752949
3-[(3-chloro-2-methylsulfanylphenyl)methyl]-1-(3,4-dimethoxyphenyl)-2,4-dioxo-1,3-diazinane-5-carboxylic acid (PubChem CID 138752949) has the molecular formula C21H21ClN2O6S and a molecular weight of 464.93 g/mol. Its IUPAC name is 3-[(3-chloro-2-methylsulfanylphenyl)methyl]-1-(3,4-dimethoxyphenyl)-2,4-dioxo-1,3-diazinane-5-carboxylic acid.
| Compound Name | 3-[(3-chloro-2-methylsulfanylphenyl)methyl]-1-(3,4-dimethoxyphenyl)-2,4-dioxo-1,3-diazinane-5-carboxylic acid |
|---|---|
| PubChem CID | 138752949 |
| Molecular Formula | C21H21ClN2O6S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 3-[(3-chloro-2-methylsulfanylphenyl)methyl]-1-(3,4-dimethoxyphenyl)-2,4-dioxo-1,3-diazinane-5-carboxylic acid |
| SMILES | COc1ccc(N2CC(C(=O)O)C(=O)N(Cc3cccc(Cl)c3SC)C2=O)cc1OC |
| InChI | InChI=1S/C21H21ClN2O6S/c1-29-16-8-7-13(9-17(16)30-2)23-11-14(20(26)27)19(25)24(21(23)28)10-12-5-4-6-15(22)18(12)31-3/h4-9,14H,10-11H2,1-3H3,(H,26,27) |
| InChIKey | IIQLDMDUDMOJAZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|