C22H36FN7O4 — CID 138753326
(2R)-N'-[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-5-fluoro-2-methylpyrimidin-4-yl]-2-(cyclopentylmethyl)-3-[hydroxy(hydroxymethyl)amino]propanehydrazide (PubChem CID 138753326) has the molecular formula C22H36FN7O4 and a molecular weight of 481.57 g/mol. Its IUPAC name is (2R)-N'-[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-5-fluoro-2-methylpyrimidin-4-yl]-2-(cyclopentylmethyl)-3-[hydroxy(hydroxymethyl)amino]propanehydrazide.
| Compound Name | (2R)-N'-[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-5-fluoro-2-methylpyrimidin-4-yl]-2-(cyclopentylmethyl)-3-[hydroxy(hydroxymethyl)amino]propanehydrazide |
|---|---|
| PubChem CID | 138753326 |
| Molecular Formula | C22H36FN7O4 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | (2R)-N'-[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-5-fluoro-2-methylpyrimidin-4-yl]-2-(cyclopentylmethyl)-3-[hydroxy(hydroxymethyl)amino]propanehydrazide |
| SMILES | Cc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)CO)c(F)c(N2CCN3CCOC[C@@H]3C2)n1 |
| InChI | InChI=1S/C22H36FN7O4/c1-15-24-20(19(23)21(25-15)29-7-6-28-8-9-34-13-18(28)12-29)26-27-22(32)17(11-30(33)14-31)10-16-4-2-3-5-16/h16-18,31,33H,2-14H2,1H3,(H,27,32)(H,24,25,26)/t17-,18+/m1/s1 |
| InChIKey | ZUQCOBLJLUYLKK-MSOLQXFVSA-N |
| XLogP | 0.73 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|