C40H69O4P — CID 138753328
[(3R)-3,31-dimethyl-7,11,15,19,23,27-hexamethylidenedotriacont-31-enyl] dihydrogen phosphate (PubChem CID 138753328) has the molecular formula C40H69O4P and a molecular weight of 644.96 g/mol. Its IUPAC name is [(3R)-3,31-dimethyl-7,11,15,19,23,27-hexamethylidenedotriacont-31-enyl] dihydrogen phosphate.
| Compound Name | [(3R)-3,31-dimethyl-7,11,15,19,23,27-hexamethylidenedotriacont-31-enyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 138753328 |
| Molecular Formula | C40H69O4P |
| Molecular Weight | 644.96 g/mol |
| Exact Mass | 644.49 |
| IUPAC Name | [(3R)-3,31-dimethyl-7,11,15,19,23,27-hexamethylidenedotriacont-31-enyl] dihydrogen phosphate |
| SMILES | C=C(C)CCCC(=C)CCCC(=C)CCCC(=C)CCCC(=C)CCCC(=C)CCCC(=C)CCC[C@@H](C)CCOP(=O)(O)O |
| InChI | InChI=1S/C40H69O4P/c1-33(2)17-10-18-34(3)19-11-20-35(4)21-12-22-36(5)23-13-24-37(6)25-14-26-38(7)27-15-28-39(8)29-16-30-40(9)31-32-44-45(41,42)43/h40H,1,3-8,10-32H2,2,9H3,(H2,41,42,43)/t40-/m1/s1 |
| InChIKey | CTKMEBTWSXRRSJ-RRHRGVEJSA-N |
| XLogP | 13.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.96 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|