C26H22N2OS2+2 — CID 138753339
2,4-bis[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenol (PubChem CID 138753339) has the molecular formula C26H22N2OS2+2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 2,4-bis[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenol.
| Compound Name | 2,4-bis[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 138753339 |
| Molecular Formula | C26H22N2OS2+2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2,4-bis[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenol |
| SMILES | C[n+]1c(/C=C/c2ccc(O)c(/C=C/c3sc4ccccc4[n+]3C)c2)sc2ccccc21 |
| InChI | InChI=1S/C26H21N2OS2/c1-27-20-7-3-5-9-23(20)30-25(27)15-12-18-11-14-22(29)19(17-18)13-16-26-28(2)21-8-4-6-10-24(21)31-26/h3-17H,1-2H3/q+1/p+1 |
| InChIKey | ZYZHFHLUSJZEIK-UHFFFAOYSA-O |
| XLogP | 5.81 |
| TPSA | 27.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|