C6H10O4 — CID 138753617
(2R,3R,6R)-2-methyl-3,6-dihydro-2H-pyran-3,4,6-triol (PubChem CID 138753617) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (2R,3R,6R)-2-methyl-3,6-dihydro-2H-pyran-3,4,6-triol.
| Compound Name | (2R,3R,6R)-2-methyl-3,6-dihydro-2H-pyran-3,4,6-triol |
|---|---|
| PubChem CID | 138753617 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (2R,3R,6R)-2-methyl-3,6-dihydro-2H-pyran-3,4,6-triol |
| SMILES | C[C@H]1O[C@@H](O)C=C(O)[C@@H]1O |
| InChI | InChI=1S/C6H10O4/c1-3-6(9)4(7)2-5(8)10-3/h2-3,5-9H,1H3/t3-,5-,6-/m1/s1 |
| InChIKey | VXYKBROYMLLNEN-UYFOZJQFSA-N |
| XLogP | -0.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |