C18H31O3- — CID 138756162
(9Z,12Z)-17-hydroxyoctadeca-9,12-dienoate (PubChem CID 138756162) has the molecular formula C18H31O3- and a molecular weight of 295.44 g/mol. Its IUPAC name is (9Z,12Z)-17-hydroxyoctadeca-9,12-dienoate.
| Compound Name | (9Z,12Z)-17-hydroxyoctadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138756162 |
| Molecular Formula | C18H31O3- |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | (9Z,12Z)-17-hydroxyoctadeca-9,12-dienoate |
| SMILES | CC(O)CCC/C=C\C/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H32O3/c1-17(19)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18(20)21/h2-3,7,9,17,19H,4-6,8,10-16H2,1H3,(H,20,21)/p-1/b3-2-,9-7- |
| InChIKey | PLKBLKWFUGXKDQ-YXRHTCTQSA-M |
| XLogP | 3.52 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|