C16H18O4 — CID 138756373
(3Z)-4-benzylidene-3-[ethoxy(hydroxy)methylidene]-6-methyloxan-2-one (PubChem CID 138756373) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (3Z)-4-benzylidene-3-[ethoxy(hydroxy)methylidene]-6-methyloxan-2-one.
| Compound Name | (3Z)-4-benzylidene-3-[ethoxy(hydroxy)methylidene]-6-methyloxan-2-one |
|---|---|
| PubChem CID | 138756373 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (3Z)-4-benzylidene-3-[ethoxy(hydroxy)methylidene]-6-methyloxan-2-one |
| SMILES | CCO/C(O)=C1\C(=O)OC(C)CC1=Cc1ccccc1 |
| InChI | InChI=1S/C16H18O4/c1-3-19-15(17)14-13(9-11(2)20-16(14)18)10-12-7-5-4-6-8-12/h4-8,10-11,17H,3,9H2,1-2H3/b13-10?,15-14- |
| InChIKey | HJVHAZQHGDFHIU-RWZQFZIVSA-N |
| XLogP | 3.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|