C8H4F7KN2O2 — CID 138756377
potassium 4-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methyl-6-oxopyrimidin-2-olate (PubChem CID 138756377) has the molecular formula C8H4F7KN2O2 and a molecular weight of 332.22 g/mol. Its IUPAC name is potassium 4-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methyl-6-oxopyrimidin-2-olate.
| Compound Name | potassium 4-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methyl-6-oxopyrimidin-2-olate |
|---|---|
| PubChem CID | 138756377 |
| Molecular Formula | C8H4F7KN2O2 |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | potassium 4-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methyl-6-oxopyrimidin-2-olate |
| SMILES | Cn1c([O-])nc(C(F)(F)C(F)(F)C(F)(F)F)cc1=O.[K+] |
| InChI | InChI=1S/C8H5F7N2O2.K/c1-17-4(18)2-3(16-5(17)19)6(9,10)7(11,12)8(13,14)15;/h2H,1H3,(H,16,19);/q;+1/p-1 |
| InChIKey | OBWJRFGNOFEJQK-UHFFFAOYSA-M |
| XLogP | -1.85 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|