C9H7F7N2OS — CID 138756379
4-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methoxy-2-methylsulfanylpyrimidine (PubChem CID 138756379) has the molecular formula C9H7F7N2OS and a molecular weight of 324.22 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methoxy-2-methylsulfanylpyrimidine.
| Compound Name | 4-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methoxy-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 138756379 |
| Molecular Formula | C9H7F7N2OS |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 4-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methoxy-2-methylsulfanylpyrimidine |
| SMILES | COc1cc(C(F)(F)C(F)(F)C(F)(F)F)nc(SC)n1 |
| InChI | InChI=1S/C9H7F7N2OS/c1-19-5-3-4(17-6(18-5)20-2)7(10,11)8(12,13)9(14,15)16/h3H,1-2H3 |
| InChIKey | WQHBZWZPEBEAER-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|