C16H32O2Si2 — CID 138756387
(1S,2R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-ene-1-carbaldehyde (PubChem CID 138756387) has the molecular formula C16H32O2Si2 and a molecular weight of 312.60 g/mol. Its IUPAC name is (1S,2R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-ene-1-carbaldehyde.
| Compound Name | (1S,2R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 138756387 |
| Molecular Formula | C16H32O2Si2 |
| Molecular Weight | 312.60 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (1S,2R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-ene-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C=C[C@@H]([Si](C)(C)C)[C@@H]1C=O |
| InChI | InChI=1S/C16H32O2Si2/c1-16(2,3)20(7,8)18-12-13-9-10-15(14(13)11-17)19(4,5)6/h9-11,13-15H,12H2,1-8H3/t13-,14+,15+/m0/s1 |
| InChIKey | LLSLZVBADVRXOS-RRFJBIMHSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|