C17H34O2Si2 — CID 138756415
2-[(1R,2R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-en-1-yl]acetaldehyde (PubChem CID 138756415) has the molecular formula C17H34O2Si2 and a molecular weight of 326.63 g/mol. Its IUPAC name is 2-[(1R,2R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-en-1-yl]acetaldehyde.
| Compound Name | 2-[(1R,2R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-en-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 138756415 |
| Molecular Formula | C17H34O2Si2 |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-[(1R,2R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-en-1-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C=C[C@@H]([Si](C)(C)C)[C@@H]1CC=O |
| InChI | InChI=1S/C17H34O2Si2/c1-17(2,3)21(7,8)19-13-14-9-10-16(20(4,5)6)15(14)11-12-18/h9-10,12,14-16H,11,13H2,1-8H3/t14-,15+,16+/m0/s1 |
| InChIKey | SAHWCZUGOFTESA-ARFHVFGLSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|