About ethyl 6-oxooctadeca-2,4-dienoate
ethyl 6-oxooctadeca-2,4-dienoate (PubChem CID 138756468) has the molecular formula C20H34O3
and a molecular weight of 322.49 g/mol. Its IUPAC name is ethyl 6-oxooctadeca-2,4-dienoate.
Molecular Properties
| Compound Name | ethyl 6-oxooctadeca-2,4-dienoate |
| PubChem CID | 138756468 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | ethyl 6-oxooctadeca-2,4-dienoate |
| SMILES | CCCCCCCCCCCCC(=O)C=CC=CC(=O)OCC |
| InChI | InChI=1S/C20H34O3/c1-3-5-6-7-8-9-10-11-12-13-16-19(21)17-14-15-18-20(22)23-4-2/h14-15,17-18H,3-13,16H2,1-2H3 |
| InChIKey | VINZCLWSAVSQIG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-oxooctadeca-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-oxooctadeca-2,4-dienoate?
The IUPAC name of ethyl 6-oxooctadeca-2,4-dienoate (CID 138756468) is ethyl 6-oxooctadeca-2,4-dienoate.
What is the SMILES notation for ethyl 6-oxooctadeca-2,4-dienoate?
The canonical SMILES for ethyl 6-oxooctadeca-2,4-dienoate is CCCCCCCCCCCCC(=O)C=CC=CC(=O)OCC.
What is the InChIKey of ethyl 6-oxooctadeca-2,4-dienoate?
The InChIKey is VINZCLWSAVSQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O3/c1-3-5-6-7-8-9-10-11-12-13-16-19(21)17-14-15-18-20(22)23-4-2/h14-15,17-18H,3-13,16H2,1-2H3.
What are the key properties of ethyl 6-oxooctadeca-2,4-dienoate?
ethyl 6-oxooctadeca-2,4-dienoate has a molecular weight of 322.49 g/mol, XLogP of 5.54, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-oxooctadeca-2,4-dienoate is sourced from PubChem (CID 138756468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).