C9H8Cl3NO3S — CID 138756700
4-(trichloromethylsulfanyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione (PubChem CID 138756700) has the molecular formula C9H8Cl3NO3S and a molecular weight of 316.59 g/mol. Its IUPAC name is 4-(trichloromethylsulfanyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione.
| Compound Name | 4-(trichloromethylsulfanyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione |
|---|---|
| PubChem CID | 138756700 |
| Molecular Formula | C9H8Cl3NO3S |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 314.93 |
| IUPAC Name | 4-(trichloromethylsulfanyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione |
| SMILES | O=C1C2CC3OC3CC2C(=O)N1SC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H8Cl3NO3S/c10-9(11,12)17-13-7(14)3-1-5-6(16-5)2-4(3)8(13)15/h3-6H,1-2H2 |
| InChIKey | MAJVQZPYGRHOIX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|