C15H10N2O — CID 138756933
(1E,13Z,15Z)-3,11-diazatricyclo[8.7.0.02,7]heptadeca-1(17),2,5,7,9,11,13,15-octaen-4-one (PubChem CID 138756933) has the molecular formula C15H10N2O and a molecular weight of 234.26 g/mol. Its IUPAC name is (1E,13Z,15Z)-3,11-diazatricyclo[8.7.0.02,7]heptadeca-1(17),2,5,7,9,11,13,15-octaen-4-one.
| Compound Name | (1E,13Z,15Z)-3,11-diazatricyclo[8.7.0.02,7]heptadeca-1(17),2,5,7,9,11,13,15-octaen-4-one |
|---|---|
| PubChem CID | 138756933 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (1E,13Z,15Z)-3,11-diazatricyclo[8.7.0.02,7]heptadeca-1(17),2,5,7,9,11,13,15-octaen-4-one |
| SMILES | O=C1C=Cc2ccc3/c(c2=N1)=C\C=C/C=C\C=N/3 |
| InChI | InChI=1S/C15H10N2O/c18-14-9-7-11-6-8-13-12(15(11)17-14)5-3-1-2-4-10-16-13/h1-10H/b3-1-,4-2-,12-5+,16-10- |
| InChIKey | IFWGNHQWAPFYBK-SDHRBYAOSA-N |
| XLogP | 1.47 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |