About 1,4-bis(nona-2,8-diynyl)piperazine
1,4-bis(nona-2,8-diynyl)piperazine (PubChem CID 138757079) has the molecular formula C22H30N2
and a molecular weight of 322.50 g/mol. Its IUPAC name is 1,4-bis(nona-2,8-diynyl)piperazine.
Molecular Properties
| Compound Name | 1,4-bis(nona-2,8-diynyl)piperazine |
| PubChem CID | 138757079 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1,4-bis(nona-2,8-diynyl)piperazine |
| SMILES | C#CCCCCC#CCN1CCN(CC#CCCCCC#C)CC1 |
| InChI | InChI=1S/C22H30N2/c1-3-5-7-9-11-13-15-17-23-19-21-24(22-20-23)18-16-14-12-10-8-6-4-2/h1-2H,5-12,17-22H2 |
| InChIKey | NGOATKIGFFDNCW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(nona-2,8-diynyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(nona-2,8-diynyl)piperazine?
The IUPAC name of 1,4-bis(nona-2,8-diynyl)piperazine (CID 138757079) is 1,4-bis(nona-2,8-diynyl)piperazine.
What is the SMILES notation for 1,4-bis(nona-2,8-diynyl)piperazine?
The canonical SMILES for 1,4-bis(nona-2,8-diynyl)piperazine is C#CCCCCC#CCN1CCN(CC#CCCCCC#C)CC1.
What is the InChIKey of 1,4-bis(nona-2,8-diynyl)piperazine?
The InChIKey is NGOATKIGFFDNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2/c1-3-5-7-9-11-13-15-17-23-19-21-24(22-20-23)18-16-14-12-10-8-6-4-2/h1-2H,5-12,17-22H2.
What are the key properties of 1,4-bis(nona-2,8-diynyl)piperazine?
1,4-bis(nona-2,8-diynyl)piperazine has a molecular weight of 322.50 g/mol, XLogP of 3.00, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(nona-2,8-diynyl)piperazine is sourced from PubChem (CID 138757079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).