C5H8ClN5 — CID 13878
6-chloro-2-N-ethyl-1,3,5-triazine-2,4-diamine (PubChem CID 13878) has the molecular formula C5H8ClN5 and a molecular weight of 173.61 g/mol. Its IUPAC name is 6-chloro-2-N-ethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-ethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 13878 |
| Molecular Formula | C5H8ClN5 |
| Molecular Weight | 173.61 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 6-chloro-2-N-ethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C5H8ClN5/c1-2-8-5-10-3(6)9-4(7)11-5/h2H2,1H3,(H3,7,8,9,10,11) |
| InChIKey | IVENSCMCQBJAKW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.61 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |