C15H11N7 — CID 1387873
N-(pyridin-2-ylmethylideneamino)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine (PubChem CID 1387873) has the molecular formula C15H11N7 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-(pyridin-2-ylmethylideneamino)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine.
| Compound Name | N-(pyridin-2-ylmethylideneamino)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 1387873 |
| Molecular Formula | C15H11N7 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(pyridin-2-ylmethylideneamino)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| SMILES | C(=NNc1nn2cnnc2c2ccccc12)c1ccccn1 |
| InChI | InChI=1S/C15H11N7/c1-2-7-13-12(6-1)14(21-22-10-18-20-15(13)22)19-17-9-11-5-3-4-8-16-11/h1-10H,(H,19,21) |
| InChIKey | XFKUJAMCIKVVKJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|