About 1-methyl-3-phenylurea
1-methyl-3-phenylurea (PubChem CID 13880) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 1-methyl-3-phenylurea.
Molecular Properties
| Compound Name | 1-methyl-3-phenylurea |
| PubChem CID | 13880 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1-methyl-3-phenylurea |
| SMILES | CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C8H10N2O/c1-9-8(11)10-7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,10,11) |
| InChIKey | SQBHGDSDVWCPHN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-phenylurea?
The IUPAC name of 1-methyl-3-phenylurea (CID 13880) is 1-methyl-3-phenylurea.
What is the SMILES notation for 1-methyl-3-phenylurea?
The canonical SMILES for 1-methyl-3-phenylurea is CNC(=O)Nc1ccccc1.
What is the InChIKey of 1-methyl-3-phenylurea?
The InChIKey is SQBHGDSDVWCPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-9-8(11)10-7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,10,11).
What are the key properties of 1-methyl-3-phenylurea?
1-methyl-3-phenylurea has a molecular weight of 150.18 g/mol, XLogP of 1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-phenylurea is sourced from PubChem (CID 13880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).