C28H32N4O4 — CID 138805915
5-[[(2S)-1-[4-(aminomethyl)cyclohexanecarbonyl]-3-phenylpyrrolidine-2-carbonyl]amino]-1H-indole-2-carboxylic acid (PubChem CID 138805915) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 5-[[(2S)-1-[4-(aminomethyl)cyclohexanecarbonyl]-3-phenylpyrrolidine-2-carbonyl]amino]-1H-indole-2-carboxylic acid.
| Compound Name | 5-[[(2S)-1-[4-(aminomethyl)cyclohexanecarbonyl]-3-phenylpyrrolidine-2-carbonyl]amino]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 138805915 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 5-[[(2S)-1-[4-(aminomethyl)cyclohexanecarbonyl]-3-phenylpyrrolidine-2-carbonyl]amino]-1H-indole-2-carboxylic acid |
| SMILES | NCC1CCC(C(=O)N2CCC(c3ccccc3)[C@H]2C(=O)Nc2ccc3[nH]c(C(=O)O)cc3c2)CC1 |
| InChI | InChI=1S/C28H32N4O4/c29-16-17-6-8-19(9-7-17)27(34)32-13-12-22(18-4-2-1-3-5-18)25(32)26(33)30-21-10-11-23-20(14-21)15-24(31-23)28(35)36/h1-5,10-11,14-15,17,19,22,25,31H,6-9,12-13,16,29H2,(H,30,33)(H,35,36)/t17?,19?,22?,25-/m0/s1 |
| InChIKey | RMGZAGPFJRIDTR-KEPAWPQZSA-N |
| XLogP | 3.95 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |