C19H22F2N6O — CID 138805947
1-acetyl-N'-[2,4-difluoro-3-(1-methylpyrazol-4-yl)phenyl]-4-(methylamino)-3,6-dihydro-2H-pyridine-5-carboximidamide (PubChem CID 138805947) has the molecular formula C19H22F2N6O and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-acetyl-N'-[2,4-difluoro-3-(1-methylpyrazol-4-yl)phenyl]-4-(methylamino)-3,6-dihydro-2H-pyridine-5-carboximidamide.
| Compound Name | 1-acetyl-N'-[2,4-difluoro-3-(1-methylpyrazol-4-yl)phenyl]-4-(methylamino)-3,6-dihydro-2H-pyridine-5-carboximidamide |
|---|---|
| PubChem CID | 138805947 |
| Molecular Formula | C19H22F2N6O |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-acetyl-N'-[2,4-difluoro-3-(1-methylpyrazol-4-yl)phenyl]-4-(methylamino)-3,6-dihydro-2H-pyridine-5-carboximidamide |
| SMILES | CNC1=C(/C(N)=N/c2ccc(F)c(-c3cnn(C)c3)c2F)CN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H22F2N6O/c1-11(28)27-7-6-15(23-2)13(10-27)19(22)25-16-5-4-14(20)17(18(16)21)12-8-24-26(3)9-12/h4-5,8-9,23H,6-7,10H2,1-3H3,(H2,22,25) |
| InChIKey | PLVSXVCWJRAMFP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|