C21H33N5O2 — CID 138806190
9,9-dimethyl-3-[3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoyl]-3,7,11-triazaspiro[5.6]dodecan-12-one (PubChem CID 138806190) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 9,9-dimethyl-3-[3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoyl]-3,7,11-triazaspiro[5.6]dodecan-12-one.
| Compound Name | 9,9-dimethyl-3-[3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoyl]-3,7,11-triazaspiro[5.6]dodecan-12-one |
|---|---|
| PubChem CID | 138806190 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 9,9-dimethyl-3-[3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoyl]-3,7,11-triazaspiro[5.6]dodecan-12-one |
| SMILES | CC1(C)CNC(=O)C2(CCN(C(=O)CCc3n[nH]c4c3CCCC4)CC2)NC1 |
| InChI | InChI=1S/C21H33N5O2/c1-20(2)13-22-19(28)21(23-14-20)9-11-26(12-10-21)18(27)8-7-17-15-5-3-4-6-16(15)24-25-17/h23H,3-14H2,1-2H3,(H,22,28)(H,24,25) |
| InChIKey | GJFOJCROGJRINT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |