C19H25N5O2S — CID 138808421
2-morpholin-4-yl-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide (PubChem CID 138808421) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide.
| Compound Name | 2-morpholin-4-yl-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 138808421 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-morpholin-4-yl-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
| SMILES | O=C(NCc1n[nH]c2c1CCC2)C1CCc2sc(N3CCOCC3)nc2C1 |
| InChI | InChI=1S/C19H25N5O2S/c25-18(20-11-16-13-2-1-3-14(13)22-23-16)12-4-5-17-15(10-12)21-19(27-17)24-6-8-26-9-7-24/h12H,1-11H2,(H,20,25)(H,22,23) |
| InChIKey | NZYYMQYBWWVBTR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |