C32H36N6O6 — CID 138808560
(9R)-9-benzyl-13-(1-ethylpyrazole-3-carbonyl)-19-methoxy-4-methyl-3,17-dioxa-7,10,13,23-tetrazatricyclo[16.3.1.12,5]tricosa-1(22),2(23),4,18,20-pentaene-8,11-dione (PubChem CID 138808560) has the molecular formula C32H36N6O6 and a molecular weight of 600.68 g/mol. Its IUPAC name is (9R)-9-benzyl-13-(1-ethylpyrazole-3-carbonyl)-19-methoxy-4-methyl-3,17-dioxa-7,10,13,23-tetrazatricyclo[16.3.1.12,5]tricosa-1(22),2(23),4,18,20-pentaene-8,11-dione.
| Compound Name | (9R)-9-benzyl-13-(1-ethylpyrazole-3-carbonyl)-19-methoxy-4-methyl-3,17-dioxa-7,10,13,23-tetrazatricyclo[16.3.1.12,5]tricosa-1(22),2(23),4,18,20-pentaene-8,11-dione |
|---|---|
| PubChem CID | 138808560 |
| Molecular Formula | C32H36N6O6 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | (9R)-9-benzyl-13-(1-ethylpyrazole-3-carbonyl)-19-methoxy-4-methyl-3,17-dioxa-7,10,13,23-tetrazatricyclo[16.3.1.12,5]tricosa-1(22),2(23),4,18,20-pentaene-8,11-dione |
| SMILES | CCn1ccc(C(=O)N2CCCOc3cc(ccc3OC)-c3nc(c(C)o3)CNC(=O)[C@@H](Cc3ccccc3)NC(=O)C2)n1 |
| InChI | InChI=1S/C32H36N6O6/c1-4-38-15-13-24(36-38)32(41)37-14-8-16-43-28-18-23(11-12-27(28)42-3)31-35-26(21(2)44-31)19-33-30(40)25(34-29(39)20-37)17-22-9-6-5-7-10-22/h5-7,9-13,15,18,25H,4,8,14,16-17,19-20H2,1-3H3,(H,33,40)(H,34,39)/t25-/m1/s1 |
| InChIKey | KHTUMNHPPQIYQZ-RUZDIDTESA-N |
| XLogP | 3.14 |
| TPSA | 140.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |