C15H15F4NO3 — CID 138808699
(3aR,6aR)-5-[[3-fluoro-2-(trifluoromethyl)phenyl]methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 138808699) has the molecular formula C15H15F4NO3 and a molecular weight of 333.28 g/mol. Its IUPAC name is (3aR,6aR)-5-[[3-fluoro-2-(trifluoromethyl)phenyl]methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[[3-fluoro-2-(trifluoromethyl)phenyl]methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 138808699 |
| Molecular Formula | C15H15F4NO3 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (3aR,6aR)-5-[[3-fluoro-2-(trifluoromethyl)phenyl]methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@]12COC[C@H]1CN(Cc1cccc(F)c1C(F)(F)F)C2 |
| InChI | InChI=1S/C15H15F4NO3/c16-11-3-1-2-9(12(11)15(17,18)19)4-20-5-10-6-23-8-14(10,7-20)13(21)22/h1-3,10H,4-8H2,(H,21,22)/t10-,14-/m1/s1 |
| InChIKey | YKXDTVJTPUCAKM-QMTHXVAHSA-N |
| XLogP | 2.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |