C14H14F3N3 — CID 138809200
6-phenyl-3-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole (PubChem CID 138809200) has the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. Its IUPAC name is 6-phenyl-3-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole.
| Compound Name | 6-phenyl-3-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole |
|---|---|
| PubChem CID | 138809200 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 6-phenyl-3-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole |
| SMILES | FC(F)(F)CCc1nnc2n1CC(c1ccccc1)C2 |
| InChI | InChI=1S/C14H14F3N3/c15-14(16,17)7-6-12-18-19-13-8-11(9-20(12)13)10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | CMLCZYMSYBRCNV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |