C19H27N3O3S — CID 138809731
[(4aR,8aR)-7-methyl-4a-(morpholine-4-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-1-yl]-thiophen-3-ylmethanone (PubChem CID 138809731) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is [(4aR,8aR)-7-methyl-4a-(morpholine-4-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [(4aR,8aR)-7-methyl-4a-(morpholine-4-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 138809731 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | [(4aR,8aR)-7-methyl-4a-(morpholine-4-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-1-yl]-thiophen-3-ylmethanone |
| SMILES | CN1CC[C@]2(C(=O)N3CCOCC3)CCCN(C(=O)c3ccsc3)[C@H]2C1 |
| InChI | InChI=1S/C19H27N3O3S/c1-20-7-5-19(18(24)21-8-10-25-11-9-21)4-2-6-22(16(19)13-20)17(23)15-3-12-26-14-15/h3,12,14,16H,2,4-11,13H2,1H3/t16-,19+/m0/s1 |
| InChIKey | QOMPXIOEYIPTMT-QFBILLFUSA-N |
| XLogP | 1.53 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |