About pyridin-2-ylmethyl acetate
pyridin-2-ylmethyl acetate (PubChem CID 13881) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is pyridin-2-ylmethyl acetate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl acetate |
| PubChem CID | 13881 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | pyridin-2-ylmethyl acetate |
| SMILES | CC(=O)OCc1ccccn1 |
| InChI | InChI=1S/C8H9NO2/c1-7(10)11-6-8-4-2-3-5-9-8/h2-5H,6H2,1H3 |
| InChIKey | KEYZUMLVDCHSTP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridin-2-ylmethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl acetate?
The IUPAC name of pyridin-2-ylmethyl acetate (CID 13881) is pyridin-2-ylmethyl acetate.
What is the SMILES notation for pyridin-2-ylmethyl acetate?
The canonical SMILES for pyridin-2-ylmethyl acetate is CC(=O)OCc1ccccn1.
What is the InChIKey of pyridin-2-ylmethyl acetate?
The InChIKey is KEYZUMLVDCHSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-7(10)11-6-8-4-2-3-5-9-8/h2-5H,6H2,1H3.
What are the key properties of pyridin-2-ylmethyl acetate?
pyridin-2-ylmethyl acetate has a molecular weight of 151.16 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl acetate is sourced from PubChem (CID 13881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).